C21H24N6O4S2 — CID 24566866
1-[4-[(5-benzyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]sulfonyl-4-methylpiperazine (PubChem CID 24566866) has the molecular formula C21H24N6O4S2 and a molecular weight of 488.60 g/mol. Its IUPAC name is 1-[4-[(5-benzyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]sulfonyl-4-methylpiperazine.
| Compound Name | 1-[4-[(5-benzyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]sulfonyl-4-methylpiperazine |
|---|---|
| PubChem CID | 24566866 |
| Molecular Formula | C21H24N6O4S2 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 1-[4-[(5-benzyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]sulfonyl-4-methylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(Sc3nnc(Cc4ccccc4)n3C)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C21H24N6O4S2/c1-24-10-12-26(13-11-24)33(30,31)17-8-9-19(18(15-17)27(28)29)32-21-23-22-20(25(21)2)14-16-6-4-3-5-7-16/h3-9,15H,10-14H2,1-2H3 |
| InChIKey | GDEZVGZTWIPHLJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 114.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|