C16H23N3O4S2 — CID 7963566
1-(4-cyclopentylsulfanyl-3-nitrophenyl)sulfonyl-4-methylpiperazine (PubChem CID 7963566) has the molecular formula C16H23N3O4S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-(4-cyclopentylsulfanyl-3-nitrophenyl)sulfonyl-4-methylpiperazine.
| Compound Name | 1-(4-cyclopentylsulfanyl-3-nitrophenyl)sulfonyl-4-methylpiperazine |
|---|---|
| PubChem CID | 7963566 |
| Molecular Formula | C16H23N3O4S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 1-(4-cyclopentylsulfanyl-3-nitrophenyl)sulfonyl-4-methylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(SC3CCCC3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C16H23N3O4S2/c1-17-8-10-18(11-9-17)25(22,23)14-6-7-16(15(12-14)19(20)21)24-13-4-2-3-5-13/h6-7,12-13H,2-5,8-11H2,1H3 |
| InChIKey | GDCNPZDHUJNQGL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|