C19H20N6O4S2 — CID 24631988
1-methyl-4-[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]sulfonylpiperazine (PubChem CID 24631988) has the molecular formula C19H20N6O4S2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 1-methyl-4-[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]sulfonylpiperazine.
| Compound Name | 1-methyl-4-[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 24631988 |
| Molecular Formula | C19H20N6O4S2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-methyl-4-[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]sulfonylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(Sc3n[nH]c(-c4ccccc4)n3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C19H20N6O4S2/c1-23-9-11-24(12-10-23)31(28,29)15-7-8-17(16(13-15)25(26)27)30-19-20-18(21-22-19)14-5-3-2-4-6-14/h2-8,13H,9-12H2,1H3,(H,20,21,22) |
| InChIKey | MDYJLIGXHSVKEJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|