C11H12N4O4S2 — CID 18208957
5-ethyl-3-(4-methylsulfonyl-2-nitrophenyl)sulfanyl-1H-1,2,4-triazole (PubChem CID 18208957) has the molecular formula C11H12N4O4S2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 5-ethyl-3-(4-methylsulfonyl-2-nitrophenyl)sulfanyl-1H-1,2,4-triazole.
| Compound Name | 5-ethyl-3-(4-methylsulfonyl-2-nitrophenyl)sulfanyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 18208957 |
| Molecular Formula | C11H12N4O4S2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 5-ethyl-3-(4-methylsulfonyl-2-nitrophenyl)sulfanyl-1H-1,2,4-triazole |
| SMILES | CCc1nc(Sc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C11H12N4O4S2/c1-3-10-12-11(14-13-10)20-9-5-4-7(21(2,18)19)6-8(9)15(16)17/h4-6H,3H2,1-2H3,(H,12,13,14) |
| InChIKey | GTEFAHCRMLKSRY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|