C15H21N5O4S2 — CID 24623898
N,N-diethyl-3-nitro-4-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenesulfonamide (PubChem CID 24623898) has the molecular formula C15H21N5O4S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is N,N-diethyl-3-nitro-4-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-nitro-4-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24623898 |
| Molecular Formula | C15H21N5O4S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N,N-diethyl-3-nitro-4-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Sc2n[nH]c(C(C)C)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H21N5O4S2/c1-5-19(6-2)26(23,24)11-7-8-13(12(9-11)20(21)22)25-15-16-14(10(3)4)17-18-15/h7-10H,5-6H2,1-4H3,(H,16,17,18) |
| InChIKey | IINCLGPTSCITSG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|