C13H18N6O4S2 — CID 24564618
4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 24564618) has the molecular formula C13H18N6O4S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24564618 |
| Molecular Formula | C13H18N6O4S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Sc2nnc(C)n2N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H18N6O4S2/c1-4-17(5-2)25(22,23)10-6-7-12(11(8-10)19(20)21)24-13-16-15-9(3)18(13)14/h6-8H,4-5,14H2,1-3H3 |
| InChIKey | DNYUYWZLFRCMFZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 137.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|