C17H23N5O4S2 — CID 24607447
4-[(5-cyclopentyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 24607447) has the molecular formula C17H23N5O4S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 4-[(5-cyclopentyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(5-cyclopentyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24607447 |
| Molecular Formula | C17H23N5O4S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 4-[(5-cyclopentyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Sc2n[nH]c(C3CCCC3)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H23N5O4S2/c1-3-21(4-2)28(25,26)13-9-10-15(14(11-13)22(23)24)27-17-18-16(19-20-17)12-7-5-6-8-12/h9-12H,3-8H2,1-2H3,(H,18,19,20) |
| InChIKey | OLHXFGYSHCADAT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|