C12H9N5O2S — CID 133464096
3-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-nitrobenzonitrile (PubChem CID 133464096) has the molecular formula C12H9N5O2S and a molecular weight of 287.30 g/mol. Its IUPAC name is 3-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-nitrobenzonitrile.
| Compound Name | 3-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-nitrobenzonitrile |
|---|---|
| PubChem CID | 133464096 |
| Molecular Formula | C12H9N5O2S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-nitrobenzonitrile |
| SMILES | N#Cc1ccc([N+](=O)[O-])c(Sc2n[nH]c(C3CC3)n2)c1 |
| InChI | InChI=1S/C12H9N5O2S/c13-6-7-1-4-9(17(18)19)10(5-7)20-12-14-11(15-16-12)8-2-3-8/h1,4-5,8H,2-3H2,(H,14,15,16) |
| InChIKey | WNDUYIXMFUGKBN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|