C15H16N6O2S — CID 125137965
3-[[4-methyl-5-[(3R)-piperidin-3-yl]-1,2,4-triazol-3-yl]sulfanyl]-4-nitrobenzonitrile (PubChem CID 125137965) has the molecular formula C15H16N6O2S and a molecular weight of 344.40 g/mol. Its IUPAC name is 3-[[4-methyl-5-[(3R)-piperidin-3-yl]-1,2,4-triazol-3-yl]sulfanyl]-4-nitrobenzonitrile.
| Compound Name | 3-[[4-methyl-5-[(3R)-piperidin-3-yl]-1,2,4-triazol-3-yl]sulfanyl]-4-nitrobenzonitrile |
|---|---|
| PubChem CID | 125137965 |
| Molecular Formula | C15H16N6O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 3-[[4-methyl-5-[(3R)-piperidin-3-yl]-1,2,4-triazol-3-yl]sulfanyl]-4-nitrobenzonitrile |
| SMILES | Cn1c(Sc2cc(C#N)ccc2[N+](=O)[O-])nnc1[C@@H]1CCCNC1 |
| InChI | InChI=1S/C15H16N6O2S/c1-20-14(11-3-2-6-17-9-11)18-19-15(20)24-13-7-10(8-16)4-5-12(13)21(22)23/h4-5,7,11,17H,2-3,6,9H2,1H3/t11-/m1/s1 |
| InChIKey | MBVRCKZZZCSWAW-LLVKDONJSA-N |
| XLogP | 2.21 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|