C15H19ClN6O2S — CID 133304706
3-chloro-5-nitro-2-[(5-piperidin-3-yl-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyridine (PubChem CID 133304706) has the molecular formula C15H19ClN6O2S and a molecular weight of 382.88 g/mol. Its IUPAC name is 3-chloro-5-nitro-2-[(5-piperidin-3-yl-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyridine.
| Compound Name | 3-chloro-5-nitro-2-[(5-piperidin-3-yl-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyridine |
|---|---|
| PubChem CID | 133304706 |
| Molecular Formula | C15H19ClN6O2S |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 3-chloro-5-nitro-2-[(5-piperidin-3-yl-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyridine |
| SMILES | CC(C)n1c(Sc2ncc([N+](=O)[O-])cc2Cl)nnc1C1CCCNC1 |
| InChI | InChI=1S/C15H19ClN6O2S/c1-9(2)21-13(10-4-3-5-17-7-10)19-20-15(21)25-14-12(16)6-11(8-18-14)22(23)24/h6,8-10,17H,3-5,7H2,1-2H3 |
| InChIKey | DNWLXDURDPWSAO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|