C13H18ClN3O4S — CID 119970329
2-chloro-4-nitro-N-(1-piperidin-3-ylethyl)benzenesulfonamide (PubChem CID 119970329) has the molecular formula C13H18ClN3O4S and a molecular weight of 347.82 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-(1-piperidin-3-ylethyl)benzenesulfonamide.
| Compound Name | 2-chloro-4-nitro-N-(1-piperidin-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119970329 |
| Molecular Formula | C13H18ClN3O4S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2-chloro-4-nitro-N-(1-piperidin-3-ylethyl)benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc([N+](=O)[O-])cc1Cl)C1CCCNC1 |
| InChI | InChI=1S/C13H18ClN3O4S/c1-9(10-3-2-6-15-8-10)16-22(20,21)13-5-4-11(17(18)19)7-12(13)14/h4-5,7,9-10,15-16H,2-3,6,8H2,1H3 |
| InChIKey | WIIOHSMYVZQWAF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|