C14H21N3O5S — CID 119970253
4-methoxy-2-nitro-N-(1-piperidin-3-ylethyl)benzenesulfonamide (PubChem CID 119970253) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-methoxy-2-nitro-N-(1-piperidin-3-ylethyl)benzenesulfonamide.
| Compound Name | 4-methoxy-2-nitro-N-(1-piperidin-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119970253 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-methoxy-2-nitro-N-(1-piperidin-3-ylethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C2CCCNC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H21N3O5S/c1-10(11-4-3-7-15-9-11)16-23(20,21)14-6-5-12(22-2)8-13(14)17(18)19/h5-6,8,10-11,15-16H,3-4,7,9H2,1-2H3 |
| InChIKey | PVIZCDJMIWCUBU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|