C11H8N4O2S3 — CID 133478355
3-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-4-nitrobenzonitrile (PubChem CID 133478355) has the molecular formula C11H8N4O2S3 and a molecular weight of 324.41 g/mol. Its IUPAC name is 3-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-4-nitrobenzonitrile.
| Compound Name | 3-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-4-nitrobenzonitrile |
|---|---|
| PubChem CID | 133478355 |
| Molecular Formula | C11H8N4O2S3 |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 3-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-4-nitrobenzonitrile |
| SMILES | CCSc1nnc(Sc2cc(C#N)ccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H8N4O2S3/c1-2-18-10-13-14-11(20-10)19-9-5-7(6-12)3-4-8(9)15(16)17/h3-5H,2H2,1H3 |
| InChIKey | SLUPKFMGVPPSLE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 92.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|