C13H10N4O2S3 — CID 51194232
2-ethylsulfanyl-5-(8-nitroisoquinolin-5-yl)sulfanyl-1,3,4-thiadiazole (PubChem CID 51194232) has the molecular formula C13H10N4O2S3 and a molecular weight of 350.45 g/mol. Its IUPAC name is 2-ethylsulfanyl-5-(8-nitroisoquinolin-5-yl)sulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-ethylsulfanyl-5-(8-nitroisoquinolin-5-yl)sulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 51194232 |
| Molecular Formula | C13H10N4O2S3 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 2-ethylsulfanyl-5-(8-nitroisoquinolin-5-yl)sulfanyl-1,3,4-thiadiazole |
| SMILES | CCSc1nnc(Sc2ccc([N+](=O)[O-])c3cnccc23)s1 |
| InChI | InChI=1S/C13H10N4O2S3/c1-2-20-12-15-16-13(22-12)21-11-4-3-10(17(18)19)9-7-14-6-5-8(9)11/h3-7H,2H2,1H3 |
| InChIKey | GZDXGLHAPPKOIS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|