C11H10FN3O3S3 — CID 133425698
2-ethylsulfanyl-5-(3-fluoro-5-methoxy-2-nitrophenyl)sulfanyl-1,3,4-thiadiazole (PubChem CID 133425698) has the molecular formula C11H10FN3O3S3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-ethylsulfanyl-5-(3-fluoro-5-methoxy-2-nitrophenyl)sulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-ethylsulfanyl-5-(3-fluoro-5-methoxy-2-nitrophenyl)sulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 133425698 |
| Molecular Formula | C11H10FN3O3S3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 2-ethylsulfanyl-5-(3-fluoro-5-methoxy-2-nitrophenyl)sulfanyl-1,3,4-thiadiazole |
| SMILES | CCSc1nnc(Sc2cc(OC)cc(F)c2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H10FN3O3S3/c1-3-19-10-13-14-11(21-10)20-8-5-6(18-2)4-7(12)9(8)15(16)17/h4-5H,3H2,1-2H3 |
| InChIKey | OJKVTBVHNQGVRI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|