C15H8N4O3S — CID 133478360
4-nitro-3-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzonitrile (PubChem CID 133478360) has the molecular formula C15H8N4O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is 4-nitro-3-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzonitrile.
| Compound Name | 4-nitro-3-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzonitrile |
|---|---|
| PubChem CID | 133478360 |
| Molecular Formula | C15H8N4O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 4-nitro-3-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzonitrile |
| SMILES | N#Cc1ccc([N+](=O)[O-])c(Sc2nnc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C15H8N4O3S/c16-9-10-6-7-12(19(20)21)13(8-10)23-15-18-17-14(22-15)11-4-2-1-3-5-11/h1-8H |
| InChIKey | DTJMLQGMYQNGBZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 105.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|