C16H10ClN3O4S — CID 9333358
1-[4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-nitrophenyl]ethanone (PubChem CID 9333358) has the molecular formula C16H10ClN3O4S and a molecular weight of 375.79 g/mol. Its IUPAC name is 1-[4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 9333358 |
| Molecular Formula | C16H10ClN3O4S |
| Molecular Weight | 375.79 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 1-[4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1ccc(Sc2nnc(-c3ccc(Cl)cc3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10ClN3O4S/c1-9(21)11-4-7-14(13(8-11)20(22)23)25-16-19-18-15(24-16)10-2-5-12(17)6-3-10/h2-8H,1H3 |
| InChIKey | MMACGXFMIAPLST-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 99.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.79 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|