C20H17Cl2N5O4S — CID 26660427
1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone (PubChem CID 26660427) has the molecular formula C20H17Cl2N5O4S and a molecular weight of 494.36 g/mol. Its IUPAC name is 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 26660427 |
| Molecular Formula | C20H17Cl2N5O4S |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)o1)N1CCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H17Cl2N5O4S/c21-14-3-1-13(2-4-14)19-23-24-20(31-19)32-12-18(28)26-9-7-25(8-10-26)16-6-5-15(22)11-17(16)27(29)30/h1-6,11H,7-10,12H2 |
| InChIKey | VQNRIZOAJZLYGU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 105.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|