C10H9N5O4S — CID 76937843
N'-hydroxy-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-nitrobenzenecarboximidamide (PubChem CID 76937843) has the molecular formula C10H9N5O4S and a molecular weight of 295.28 g/mol. Its IUPAC name is N'-hydroxy-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-nitrobenzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-nitrobenzenecarboximidamide |
|---|---|
| PubChem CID | 76937843 |
| Molecular Formula | C10H9N5O4S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | N'-hydroxy-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-nitrobenzenecarboximidamide |
| SMILES | Cc1nnc(Sc2ccc(C(N)=NO)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C10H9N5O4S/c1-5-12-13-10(19-5)20-8-3-2-6(9(11)14-16)4-7(8)15(17)18/h2-4,16H,1H3,(H2,11,14) |
| InChIKey | POLLQFFLKCBOMB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|