C11H10N4O4S — CID 106922613
N'-hydroxy-4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-3-nitrobenzenecarboximidamide (PubChem CID 106922613) has the molecular formula C11H10N4O4S and a molecular weight of 294.29 g/mol. Its IUPAC name is N'-hydroxy-4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-3-nitrobenzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-3-nitrobenzenecarboximidamide |
|---|---|
| PubChem CID | 106922613 |
| Molecular Formula | C11H10N4O4S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | N'-hydroxy-4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-3-nitrobenzenecarboximidamide |
| SMILES | Cc1coc(Sc2ccc(/C(N)=N/O)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H10N4O4S/c1-6-5-19-11(13-6)20-9-3-2-7(10(12)14-16)4-8(9)15(17)18/h2-5,16H,1H3,(H2,12,14) |
| InChIKey | NCMJXPVCKXJDFA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 127.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|