C10H10N6O4S — CID 76976868
N'-hydroxy-4-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzenecarboximidamide (PubChem CID 76976868) has the molecular formula C10H10N6O4S and a molecular weight of 310.30 g/mol. Its IUPAC name is N'-hydroxy-4-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzenecarboximidamide |
|---|---|
| PubChem CID | 76976868 |
| Molecular Formula | C10H10N6O4S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | N'-hydroxy-4-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzenecarboximidamide |
| SMILES | Cn1c(Sc2ccc(C(N)=NO)cc2[N+](=O)[O-])n[nH]c1=O |
| InChI | InChI=1S/C10H10N6O4S/c1-15-9(17)12-13-10(15)21-7-3-2-5(8(11)14-18)4-6(7)16(19)20/h2-4,18H,1H3,(H2,11,14)(H,12,17) |
| InChIKey | ILDNVFXINXZSTP-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 152.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|