C10H9BrFN5O2S — CID 107537006
2-bromo-3-fluoro-N'-hydroxy-4-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide (PubChem CID 107537006) has the molecular formula C10H9BrFN5O2S and a molecular weight of 362.18 g/mol. Its IUPAC name is 2-bromo-3-fluoro-N'-hydroxy-4-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 2-bromo-3-fluoro-N'-hydroxy-4-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 107537006 |
| Molecular Formula | C10H9BrFN5O2S |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 2-bromo-3-fluoro-N'-hydroxy-4-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide |
| SMILES | Cn1c(Sc2ccc(/C(N)=N/O)c(Br)c2F)n[nH]c1=O |
| InChI | InChI=1S/C10H9BrFN5O2S/c1-17-9(18)14-15-10(17)20-5-3-2-4(8(13)16-19)6(11)7(5)12/h2-3,19H,1H3,(H2,13,16)(H,14,18) |
| InChIKey | OFVWBGQWECAUHK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|