C6H11N5O2S — CID 76976872
N'-hydroxy-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]propanimidamide (PubChem CID 76976872) has the molecular formula C6H11N5O2S and a molecular weight of 217.25 g/mol. Its IUPAC name is N'-hydroxy-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]propanimidamide.
| Compound Name | N'-hydroxy-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]propanimidamide |
|---|---|
| PubChem CID | 76976872 |
| Molecular Formula | C6H11N5O2S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | N'-hydroxy-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]propanimidamide |
| SMILES | CC(Sc1n[nH]c(=O)n1C)C(N)=NO |
| InChI | InChI=1S/C6H11N5O2S/c1-3(4(7)10-13)14-6-9-8-5(12)11(6)2/h3,13H,1-2H3,(H2,7,10)(H,8,12) |
| InChIKey | RREBWORVYJSWHE-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|