C8H15N5O2S — CID 76975661
2-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxybutanimidamide (PubChem CID 76975661) has the molecular formula C8H15N5O2S and a molecular weight of 245.31 g/mol. Its IUPAC name is 2-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxybutanimidamide.
| Compound Name | 2-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 76975661 |
| Molecular Formula | C8H15N5O2S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxybutanimidamide |
| SMILES | CCC(Sc1n[nH]c(=O)n1CC)C(N)=NO |
| InChI | InChI=1S/C8H15N5O2S/c1-3-5(6(9)12-15)16-8-11-10-7(14)13(8)4-2/h5,15H,3-4H2,1-2H3,(H2,9,12)(H,10,14) |
| InChIKey | ICCBFZOUMYPNHM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|