C11H13N5O2S — CID 63579952
2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetohydrazide (PubChem CID 63579952) has the molecular formula C11H13N5O2S and a molecular weight of 279.33 g/mol. Its IUPAC name is 2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetohydrazide.
| Compound Name | 2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 63579952 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetohydrazide |
| SMILES | Cn1c(SC(C(=O)NN)c2ccccc2)n[nH]c1=O |
| InChI | InChI=1S/C11H13N5O2S/c1-16-10(18)14-15-11(16)19-8(9(17)13-12)7-5-3-2-4-6-7/h2-6,8H,12H2,1H3,(H,13,17)(H,14,18) |
| InChIKey | MGTVRGPQBDRYPY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|