C10H10N4OS2 — CID 63581169
2-phenyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetohydrazide (PubChem CID 63581169) has the molecular formula C10H10N4OS2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 2-phenyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetohydrazide.
| Compound Name | 2-phenyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetohydrazide |
|---|---|
| PubChem CID | 63581169 |
| Molecular Formula | C10H10N4OS2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2-phenyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetohydrazide |
| SMILES | NNC(=O)C(Sc1nncs1)c1ccccc1 |
| InChI | InChI=1S/C10H10N4OS2/c11-13-9(15)8(7-4-2-1-3-5-7)17-10-14-12-6-16-10/h1-6,8H,11H2,(H,13,15) |
| InChIKey | QRHFKXHTKVPAJH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|