C16H14N4OS2 — CID 24557252
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N,2-diphenylacetamide (PubChem CID 24557252) has the molecular formula C16H14N4OS2 and a molecular weight of 342.45 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N,2-diphenylacetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 24557252 |
| Molecular Formula | C16H14N4OS2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N,2-diphenylacetamide |
| SMILES | Nc1nnc(SC(C(=O)Nc2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C16H14N4OS2/c17-15-19-20-16(23-15)22-13(11-7-3-1-4-8-11)14(21)18-12-9-5-2-6-10-12/h1-10,13H,(H2,17,19)(H,18,21) |
| InChIKey | JBCVQPGXGRTZJD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |