C17H15N5O3S2 — CID 7760120
(2R)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide (PubChem CID 7760120) has the molecular formula C17H15N5O3S2 and a molecular weight of 401.47 g/mol. Its IUPAC name is (2R)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide.
| Compound Name | (2R)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 7760120 |
| Molecular Formula | C17H15N5O3S2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | (2R)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide |
| SMILES | Cc1ccc(NC(=O)[C@H](Sc2nnc(N)s2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15N5O3S2/c1-10-7-8-12(13(9-10)22(24)25)19-15(23)14(11-5-3-2-4-6-11)26-17-21-20-16(18)27-17/h2-9,14H,1H3,(H2,18,20)(H,19,23)/t14-/m1/s1 |
| InChIKey | JKOTWQBPOREBPN-CQSZACIVSA-N |
| XLogP | 3.81 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|