C25H24N6O4S — CID 16960159
2-[[4-amino-5-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide (PubChem CID 16960159) has the molecular formula C25H24N6O4S and a molecular weight of 504.57 g/mol. Its IUPAC name is 2-[[4-amino-5-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide.
| Compound Name | 2-[[4-amino-5-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 16960159 |
| Molecular Formula | C25H24N6O4S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 2-[[4-amino-5-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide |
| SMILES | CCOc1ccc(-c2nnc(SC(C(=O)Nc3ccc(C)cc3[N+](=O)[O-])c3ccccc3)n2N)cc1 |
| InChI | InChI=1S/C25H24N6O4S/c1-3-35-19-12-10-18(11-13-19)23-28-29-25(30(23)26)36-22(17-7-5-4-6-8-17)24(32)27-20-14-9-16(2)15-21(20)31(33)34/h4-15,22H,3,26H2,1-2H3,(H,27,32) |
| InChIKey | CATAVGRVUQMGLM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|