C14H13N3O3S — CID 63581022
2-(4-nitrophenyl)sulfanyl-2-phenylacetohydrazide (PubChem CID 63581022) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-(4-nitrophenyl)sulfanyl-2-phenylacetohydrazide.
| Compound Name | 2-(4-nitrophenyl)sulfanyl-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 63581022 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-(4-nitrophenyl)sulfanyl-2-phenylacetohydrazide |
| SMILES | NNC(=O)C(Sc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C14H13N3O3S/c15-16-14(18)13(10-4-2-1-3-5-10)21-12-8-6-11(7-9-12)17(19)20/h1-9,13H,15H2,(H,16,18) |
| InChIKey | ZCRAUDPCSNDVJA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|