C20H15FN2O3S — CID 1343901
(2R)-N-(2-fluoro-5-nitrophenyl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 1343901) has the molecular formula C20H15FN2O3S and a molecular weight of 382.42 g/mol. Its IUPAC name is (2R)-N-(2-fluoro-5-nitrophenyl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | (2R)-N-(2-fluoro-5-nitrophenyl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 1343901 |
| Molecular Formula | C20H15FN2O3S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (2R)-N-(2-fluoro-5-nitrophenyl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1F)[C@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15FN2O3S/c21-17-12-11-15(23(25)26)13-18(17)22-20(24)19(14-7-3-1-4-8-14)27-16-9-5-2-6-10-16/h1-13,19H,(H,22,24)/t19-/m1/s1 |
| InChIKey | LOMFSNXLUXYONN-LJQANCHMSA-N |
| XLogP | 5.21 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|