C28H21Cl2N3O4S — CID 21170406
2,4-dichloro-N-[4-[2-(2-methyl-4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide (PubChem CID 21170406) has the molecular formula C28H21Cl2N3O4S and a molecular weight of 566.47 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[2-(2-methyl-4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[2-(2-methyl-4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 21170406 |
| Molecular Formula | C28H21Cl2N3O4S |
| Molecular Weight | 566.47 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | 2,4-dichloro-N-[4-[2-(2-methyl-4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C(Sc1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H21Cl2N3O4S/c1-17-15-21(33(36)37)10-14-25(17)32-28(35)26(18-5-3-2-4-6-18)38-22-11-8-20(9-12-22)31-27(34)23-13-7-19(29)16-24(23)30/h2-16,26H,1H3,(H,31,34)(H,32,35) |
| InChIKey | JYFDUJFUFAEBER-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.47 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|