C21H17FN2O3 — CID 4043303
N-(2-fluoro-5-nitrophenyl)-3,3-diphenylpropanamide (PubChem CID 4043303) has the molecular formula C21H17FN2O3 and a molecular weight of 364.38 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-3,3-diphenylpropanamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 4043303 |
| Molecular Formula | C21H17FN2O3 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C21H17FN2O3/c22-19-12-11-17(24(26)27)13-20(19)23-21(25)14-18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,18H,14H2,(H,23,25) |
| InChIKey | HBACYQLCTCWXQS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|