C16H15FN2O3 — CID 1121904
N-(2-fluoro-5-nitrophenyl)-4-phenylbutanamide (PubChem CID 1121904) has the molecular formula C16H15FN2O3 and a molecular weight of 302.31 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-4-phenylbutanamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-4-phenylbutanamide |
|---|---|
| PubChem CID | 1121904 |
| Molecular Formula | C16H15FN2O3 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-4-phenylbutanamide |
| SMILES | O=C(CCCc1ccccc1)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C16H15FN2O3/c17-14-10-9-13(19(21)22)11-15(14)18-16(20)8-4-7-12-5-2-1-3-6-12/h1-3,5-6,9-11H,4,7-8H2,(H,18,20) |
| InChIKey | HLPJSOUJQCIANM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|