C17H17FN2O4 — CID 52696119
3-(2,6-dimethylphenoxy)-N-(2-fluoro-5-nitrophenyl)propanamide (PubChem CID 52696119) has the molecular formula C17H17FN2O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is 3-(2,6-dimethylphenoxy)-N-(2-fluoro-5-nitrophenyl)propanamide.
| Compound Name | 3-(2,6-dimethylphenoxy)-N-(2-fluoro-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 52696119 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-(2,6-dimethylphenoxy)-N-(2-fluoro-5-nitrophenyl)propanamide |
| SMILES | Cc1cccc(C)c1OCCC(=O)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C17H17FN2O4/c1-11-4-3-5-12(2)17(11)24-9-8-16(21)19-15-10-13(20(22)23)6-7-14(15)18/h3-7,10H,8-9H2,1-2H3,(H,19,21) |
| InChIKey | JVCCFUWTCLNJJW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|