C14H6F6N2O3S — CID 7467427
N-(2-fluoro-5-nitrophenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide (PubChem CID 7467427) has the molecular formula C14H6F6N2O3S and a molecular weight of 396.27 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 7467427 |
| Molecular Formula | C14H6F6N2O3S |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1c(F)c(F)c(F)c(F)c1F)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C14H6F6N2O3S/c15-6-2-1-5(22(24)25)3-7(6)21-8(23)4-26-14-12(19)10(17)9(16)11(18)13(14)20/h1-3H,4H2,(H,21,23) |
| InChIKey | SEBKYYJMIUXNSX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|