C10H7BrFN3OS2 — CID 107536991
2-bromo-3-fluoro-N'-hydroxy-4-(1,3-thiazol-2-ylsulfanyl)benzenecarboximidamide (PubChem CID 107536991) has the molecular formula C10H7BrFN3OS2 and a molecular weight of 348.22 g/mol. Its IUPAC name is 2-bromo-3-fluoro-N'-hydroxy-4-(1,3-thiazol-2-ylsulfanyl)benzenecarboximidamide.
| Compound Name | 2-bromo-3-fluoro-N'-hydroxy-4-(1,3-thiazol-2-ylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 107536991 |
| Molecular Formula | C10H7BrFN3OS2 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.92 |
| IUPAC Name | 2-bromo-3-fluoro-N'-hydroxy-4-(1,3-thiazol-2-ylsulfanyl)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(Sc2nccs2)c(F)c1Br |
| InChI | InChI=1S/C10H7BrFN3OS2/c11-7-5(9(13)15-16)1-2-6(8(7)12)18-10-14-3-4-17-10/h1-4,16H,(H2,13,15) |
| InChIKey | LOXKMGWIAQYYBZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|