C11H10BrN3OS2 — CID 114893517
5-bromo-N'-hydroxy-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzenecarboximidamide (PubChem CID 114893517) has the molecular formula C11H10BrN3OS2 and a molecular weight of 344.26 g/mol. Its IUPAC name is 5-bromo-N'-hydroxy-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 5-bromo-N'-hydroxy-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 114893517 |
| Molecular Formula | C11H10BrN3OS2 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 342.94 |
| IUPAC Name | 5-bromo-N'-hydroxy-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzenecarboximidamide |
| SMILES | Cc1csc(Sc2ccc(Br)cc2/C(N)=N/O)n1 |
| InChI | InChI=1S/C11H10BrN3OS2/c1-6-5-17-11(14-6)18-9-3-2-7(12)4-8(9)10(13)15-16/h2-5,16H,1H3,(H2,13,15) |
| InChIKey | PHPWHZOJZOPXQB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|