C11H11BrN4OS2 — CID 114893582
5-bromo-2-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 114893582) has the molecular formula C11H11BrN4OS2 and a molecular weight of 359.27 g/mol. Its IUPAC name is 5-bromo-2-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 5-bromo-2-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 114893582 |
| Molecular Formula | C11H11BrN4OS2 |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 5-bromo-2-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCc1nsc(Sc2ccc(Br)cc2/C(N)=N/O)n1 |
| InChI | InChI=1S/C11H11BrN4OS2/c1-2-9-14-11(19-16-9)18-8-4-3-6(12)5-7(8)10(13)15-17/h3-5,17H,2H2,1H3,(H2,13,15) |
| InChIKey | DERGBXGHZZUSSE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|