About 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide
2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide (PubChem CID 114884443) has the molecular formula C11H11BrN4S2
and a molecular weight of 343.28 g/mol. Its IUPAC name is 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide.
Molecular Properties
| Compound Name | 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide |
| PubChem CID | 114884443 |
| Molecular Formula | C11H11BrN4S2 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(Br)cccc1Sc1nc(CC)ns1 |
| InChI | InChI=1S/C11H11BrN4S2/c1-2-8-15-11(18-16-8)17-7-5-3-4-6(12)9(7)10(13)14/h3-5H,2H2,1H3,(H3,13,14) |
| InChIKey | RHRYVHQEUOTQLV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide?
The IUPAC name of 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide (CID 114884443) is 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide.
What is the SMILES notation for 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide?
The canonical SMILES for 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide is [H]/N=C(\N)c1c(Br)cccc1Sc1nc(CC)ns1.
What is the InChIKey of 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide?
The InChIKey is RHRYVHQEUOTQLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN4S2/c1-2-8-15-11(18-16-8)17-7-5-3-4-6(12)9(7)10(13)14/h3-5H,2H2,1H3,(H3,13,14).
What are the key properties of 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide?
2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide has a molecular weight of 343.28 g/mol, XLogP of 3.30, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide is sourced from PubChem (CID 114884443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).