C11H11BrN4S2 — CID 114884443
2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide (PubChem CID 114884443) has the molecular formula C11H11BrN4S2 and a molecular weight of 343.28 g/mol. Its IUPAC name is 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 114884443 |
| Molecular Formula | C11H11BrN4S2 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 2-bromo-6-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(Br)cccc1Sc1nc(CC)ns1 |
| InChI | InChI=1S/C11H11BrN4S2/c1-2-8-15-11(18-16-8)17-7-5-3-4-6(12)9(7)10(13)14/h3-5H,2H2,1H3,(H3,13,14) |
| InChIKey | RHRYVHQEUOTQLV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|