C11H10BrFN4S2 — CID 107537123
2-bromo-4-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-3-fluorobenzenecarboximidamide (PubChem CID 107537123) has the molecular formula C11H10BrFN4S2 and a molecular weight of 361.27 g/mol. Its IUPAC name is 2-bromo-4-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-3-fluorobenzenecarboximidamide.
| Compound Name | 2-bromo-4-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 107537123 |
| Molecular Formula | C11H10BrFN4S2 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | 2-bromo-4-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2nc(CC)ns2)c(F)c1Br |
| InChI | InChI=1S/C11H10BrFN4S2/c1-2-7-16-11(19-17-7)18-6-4-3-5(10(14)15)8(12)9(6)13/h3-4H,2H2,1H3,(H3,14,15) |
| InChIKey | OOFFQZDPXDLRDW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|