C11H8BrFN4OS — CID 107537067
2-bromo-3-fluoro-4-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzenecarboximidamide (PubChem CID 107537067) has the molecular formula C11H8BrFN4OS and a molecular weight of 343.18 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 2-bromo-3-fluoro-4-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 107537067 |
| Molecular Formula | C11H8BrFN4OS |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 2-bromo-3-fluoro-4-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2nccc(=O)[nH]2)c(F)c1Br |
| InChI | InChI=1S/C11H8BrFN4OS/c12-8-5(10(14)15)1-2-6(9(8)13)19-11-16-4-3-7(18)17-11/h1-4H,(H3,14,15)(H,16,17,18) |
| InChIKey | JLGRWCJDRNXTCK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 95.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|