C13H8BrCl2FN2S — CID 107537045
2-bromo-4-(2,5-dichlorophenyl)sulfanyl-3-fluorobenzenecarboximidamide (PubChem CID 107537045) has the molecular formula C13H8BrCl2FN2S and a molecular weight of 394.10 g/mol. Its IUPAC name is 2-bromo-4-(2,5-dichlorophenyl)sulfanyl-3-fluorobenzenecarboximidamide.
| Compound Name | 2-bromo-4-(2,5-dichlorophenyl)sulfanyl-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 107537045 |
| Molecular Formula | C13H8BrCl2FN2S |
| Molecular Weight | 394.10 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | 2-bromo-4-(2,5-dichlorophenyl)sulfanyl-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2cc(Cl)ccc2Cl)c(F)c1Br |
| InChI | InChI=1S/C13H8BrCl2FN2S/c14-11-7(13(18)19)2-4-9(12(11)17)20-10-5-6(15)1-3-8(10)16/h1-5H,(H3,18,19) |
| InChIKey | YDQVKPHXHMEOHL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.10 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|