C7H5ClF2N2 — CID 174975357
4-chloro-2,3-difluorobenzenecarboximidamide (PubChem CID 174975357) has the molecular formula C7H5ClF2N2 and a molecular weight of 190.58 g/mol. Its IUPAC name is 4-chloro-2,3-difluorobenzenecarboximidamide.
| Compound Name | 4-chloro-2,3-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 174975357 |
| Molecular Formula | C7H5ClF2N2 |
| Molecular Weight | 190.58 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | 4-chloro-2,3-difluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cl)c(F)c1F |
| InChI | InChI=1S/C7H5ClF2N2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H3,11,12) |
| InChIKey | YZOSYVRQZBUICY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.58 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|