C7H6F3N3 — CID 83382918
5-amino-2,3,4-trifluorobenzenecarboximidamide (PubChem CID 83382918) has the molecular formula C7H6F3N3 and a molecular weight of 189.14 g/mol. Its IUPAC name is 5-amino-2,3,4-trifluorobenzenecarboximidamide.
| Compound Name | 5-amino-2,3,4-trifluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 83382918 |
| Molecular Formula | C7H6F3N3 |
| Molecular Weight | 189.14 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 5-amino-2,3,4-trifluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(N)c(F)c(F)c1F |
| InChI | InChI=1S/C7H6F3N3/c8-4-2(7(12)13)1-3(11)5(9)6(4)10/h1H,11H2,(H3,12,13) |
| InChIKey | NWBXJAPUOXPQNZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.14 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|