C8H8ClF3N2 — CID 174920127
2,3,5-trifluoro-4-methylbenzenecarboximidamide;hydrochloride (PubChem CID 174920127) has the molecular formula C8H8ClF3N2 and a molecular weight of 224.61 g/mol. Its IUPAC name is 2,3,5-trifluoro-4-methylbenzenecarboximidamide;hydrochloride.
| Compound Name | 2,3,5-trifluoro-4-methylbenzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 174920127 |
| Molecular Formula | C8H8ClF3N2 |
| Molecular Weight | 224.61 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 2,3,5-trifluoro-4-methylbenzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cc(F)c(C)c(F)c1F |
| InChI | InChI=1S/C8H7F3N2.ClH/c1-3-5(9)2-4(8(12)13)7(11)6(3)10;/h2H,1H3,(H3,12,13);1H |
| InChIKey | SKKNKSZDNWFZCS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.61 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|