C8H13N3 — CID 82490393
1,2,5-trimethylpyrrole-3-carboximidamide (PubChem CID 82490393) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 1,2,5-trimethylpyrrole-3-carboximidamide.
| Compound Name | 1,2,5-trimethylpyrrole-3-carboximidamide |
|---|---|
| PubChem CID | 82490393 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1,2,5-trimethylpyrrole-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)n(C)c1C |
| InChI | InChI=1S/C8H13N3/c1-5-4-7(8(9)10)6(2)11(5)3/h4H,1-3H3,(H3,9,10) |
| InChIKey | OCIDPIJCJDJHLK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|