C9H11ClF2N2 — CID 145225974
2-chloro-4,5-difluorobenzenecarboximidamide;ethane (PubChem CID 145225974) has the molecular formula C9H11ClF2N2 and a molecular weight of 220.65 g/mol. Its IUPAC name is 2-chloro-4,5-difluorobenzenecarboximidamide;ethane.
| Compound Name | 2-chloro-4,5-difluorobenzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 145225974 |
| Molecular Formula | C9H11ClF2N2 |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-chloro-4,5-difluorobenzenecarboximidamide;ethane |
| SMILES | CC.[H]/N=C(\N)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C7H5ClF2N2.C2H6/c8-4-2-6(10)5(9)1-3(4)7(11)12;1-2/h1-2H,(H3,11,12);1-2H3 |
| InChIKey | FESRQVXOAMARSP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|