C13H9Cl3N2S — CID 55223593
3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzenecarboximidamide (PubChem CID 55223593) has the molecular formula C13H9Cl3N2S and a molecular weight of 331.66 g/mol. Its IUPAC name is 3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzenecarboximidamide.
| Compound Name | 3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 55223593 |
| Molecular Formula | C13H9Cl3N2S |
| Molecular Weight | 331.66 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2cc(Cl)ccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl3N2S/c14-8-2-3-9(15)12(6-8)19-11-4-1-7(13(17)18)5-10(11)16/h1-6H,(H3,17,18) |
| InChIKey | WZPMDBSZIJLROG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|