C9H7ClN4S2 — CID 63087084
3-chloro-4-(1,3,4-thiadiazol-2-ylsulfanyl)benzenecarboximidamide (PubChem CID 63087084) has the molecular formula C9H7ClN4S2 and a molecular weight of 270.77 g/mol. Its IUPAC name is 3-chloro-4-(1,3,4-thiadiazol-2-ylsulfanyl)benzenecarboximidamide.
| Compound Name | 3-chloro-4-(1,3,4-thiadiazol-2-ylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 63087084 |
| Molecular Formula | C9H7ClN4S2 |
| Molecular Weight | 270.77 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 3-chloro-4-(1,3,4-thiadiazol-2-ylsulfanyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2nncs2)c(Cl)c1 |
| InChI | InChI=1S/C9H7ClN4S2/c10-6-3-5(8(11)12)1-2-7(6)16-9-14-13-4-15-9/h1-4H,(H3,11,12) |
| InChIKey | LNFQIBDEOXFLRI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.77 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|